MATH 141 Calculus 2 • McGill University, Montreal

Corrected exercises: geometric series, telescoping series and the divergence test (MATH 141)

This is the corrected exercise set for the first series chapter of MATH 141, Calculus 2, the second calculus course at McGill University. It follows section 11.2 of Stewart: partial sums, geometric series, telescoping series, the divergence test and the harmonic series. Every answer is exact and obtained by hand, and every solution names the first term, the ratio, the decomposition or the test it uses, because on the exam that is where the marks are.

The thread running through the whole set: a series is the limit of its PARTIAL SUMS sns_n, never of its terms ana_n. Every verdict is read off sns_n, through the geometric closed form, the cancellation of a telescoping sum, or the grouping of the harmonic series. Terms that tend to 00 are necessary for convergence and never sufficient, and the set meets three series whose terms vanish while their sum is infinite.

The traps named explicitly in the solutions: applying 11−r\frac{1}{1 - r} to a series that starts at n=1n = 1, reading the ratio off an exponent 2n2n or n+1n + 1, using the geometric formula with ∣r∣≥1|r| \ge 1, keeping one surviving term in a telescoping sum whose gap is two, splitting a series into two divergent ones, concluding convergence from an→0a_n \to 0, taking lim⁡an\lim a_n for the sum, and inserting brackets into a divergent series.

10 corrected exercises • 100 points • 150 minutes

Revision sheet for this chapter → Every MATH 141 chapter →

Course recap

  • • sn=a1+⋯+ans_n = a_1 + \dots + a_n. ∑an\sum a_n converges to ss when sn→ss_n \to s; otherwise it diverges. an=sn−sn−1a_n = s_n - s_{n-1}.
  • • Geometric: ∑n=1∞arn−1=a1−r\sum_{n=1}^{\infty} ar^{n-1} = \frac{a}{1 - r} if ∣r∣<1|r| < 1 (sum == first term over 1−r1 - r), divergent if ∣r∣≥1|r| \ge 1 and a≠0a \ne 0. Finite sum: a1−rn1−ra\frac{1 - r^n}{1 - r}.
  • • Telescoping: ∑n=1∞(bn+1−bn)\sum_{n=1}^{\infty} (b_{n+1} - b_n) has sN=bN+1−b1s_N = b_{N+1} - b_1; it converges exactly when lim⁡bn=L\lim b_n = L exists, to L−b1L - b_1.
  • • Divergence test: if lim⁡an≠0\lim a_n \ne 0 or does not exist, ∑an\sum a_n diverges. If lim⁡an=0\lim a_n = 0, the test says NOTHING.
  • • The harmonic series ∑1n\sum \frac{1}{n} diverges, although 1n→0\frac{1}{n} \to 0: s2k≥1+k2s_{2^k} \ge 1 + \frac{k}{2}.
  • • If ∑an\sum a_n and ∑bn\sum b_n converge: ∑(an+bn)=∑an+∑bn\sum (a_n + b_n) = \sum a_n + \sum b_n and ∑can=c∑an\sum ca_n = c\sum a_n. Convergent plus divergent diverges.

Part A: the basics (/50)

Exercise 1: Partial sums first: what an infinite sum means

The symbol ∑n=1∞an\sum_{n=1}^{\infty} a_n is not an addition you can carry out: nobody adds infinitely many numbers. It is DEFINED through the partial sums sn=a1+a2+⋯+ans_n = a_1 + a_2 + \dots + a_n. The series converges when the sequence (sn)(s_n) has a finite limit ss, and ss is then called the sum. Otherwise the series diverges.

The figure shows the first eight partial sums of ∑n=1∞23n\sum_{n=1}^{\infty} \frac{2}{3^n}.

1234567890.20.40.60.811.2partial sums sₙn
  • a) Compute s1s_1, s2s_2, s3s_3 and s4s_4 for ∑n=1∞23n\sum_{n=1}^{\infty} \frac{2}{3^n}, as fractions.
  • b) Show that sn=1−13ns_n = 1 - \frac{1}{3^n} by computing sn−13sns_n - \frac{1}{3}s_n.
  • c) Does the series converge? If so, give its sum and say what the figure shows.
  • d) The partial sums of another series ∑n=1∞an\sum_{n=1}^{\infty} a_n are sn=4nn+1s_n = \frac{4n}{n+1}. Find a1a_1, then ana_n for n≥2n \ge 2, and the sum of the series.
  • e) For the series of d), a student writes: the sum is lim⁡n→∞an=0\lim_{n\to\infty} a_n = 0. Explain the confusion, and give two quick reasons why 00 cannot be the sum.
Show the solution

Answers

  • a) s1=23s_1 = \frac{2}{3}, s2=89s_2 = \frac{8}{9}, s3=2627s_3 = \frac{26}{27}, s4=8081s_4 = \frac{80}{81}
  • b) 23sn=23−23n+1\frac{2}{3}s_n = \frac{2}{3} - \frac{2}{3^{n+1}}, so sn=1−13ns_n = 1 - \frac{1}{3^n}
  • c) Converges, sum 11: the points level off at height 11 without reaching it.
  • d) a1=2a_1 = 2, an=4n(n+1)a_n = \frac{4}{n(n+1)}, sum =lim⁡sn=4= \lim s_n = 4
  • e) The sum is lim⁡sn=4\lim s_n = 4, not lim⁡an\lim a_n; positive terms give a sum at least a1=2a_1 = 2.

a) Add the terms one at a time: s1=23s_1 = \frac{2}{3}, s2=23+29=89s_2 = \frac{2}{3} + \frac{2}{9} = \frac{8}{9}, s3=89+227=2627s_3 = \frac{8}{9} + \frac{2}{27} = \frac{26}{27}, s4=2627+281=8081s_4 = \frac{26}{27} + \frac{2}{81} = \frac{80}{81}. A pattern is already visible: each partial sum is 11 minus a power of 13\frac{1}{3}, namely 3n−13n\frac{3^n - 1}{3^n}. Computing the first three or four partial sums is never wasted on an exam: it is the only way to see what the series does before proving it, and it checks every closed form you will write afterwards.

b) sn=23+232+⋯+23ns_n = \frac{2}{3} + \frac{2}{3^2} + \dots + \frac{2}{3^n} and 13sn=232+⋯+23n+23n+1\frac{1}{3}s_n = \frac{2}{3^2} + \dots + \frac{2}{3^n} + \frac{2}{3^{n+1}}. Subtracting, every term cancels except the first of sns_n and the last of 13sn\frac{1}{3}s_n: 23sn=23−23n+1\frac{2}{3}s_n = \frac{2}{3} - \frac{2}{3^{n+1}}. Multiply by 32\frac{3}{2}: sn=1−13ns_n = 1 - \frac{1}{3^n}. Check with a): n=3n = 3 gives 1−127=26271 - \frac{1}{27} = \frac{26}{27}. This subtraction is exactly the proof of the geometric sum formula, and it is worth knowing because it works on a FINITE sum, where nothing can go wrong.

c) Since 13n→0\frac{1}{3^n} \to 0, sn→1s_n \to 1: the series converges and ∑n=1∞23n=1\sum_{n=1}^{\infty} \frac{2}{3^n} = 1. On the figure the points climb (every term is positive, so sns_n increases) and flatten out just below height 11, which they never reach: sn<1s_n < 1 for every nn. The sum is the LEVEL the partial sums approach, not a partial sum. Writing the conclusion as a limit of sns_n is the sentence the marker looks for: the series converges BECAUSE its partial sums have a limit.

d) The first partial sum is the first term: a1=s1=42=2a_1 = s_1 = \frac{4}{2} = 2. For n≥2n \ge 2, an=sn−sn−1=4nn+1−4(n−1)n=4n2−4(n−1)(n+1)n(n+1)=4n2−4n2+4n(n+1)=4n(n+1)a_n = s_n - s_{n-1} = \frac{4n}{n+1} - \frac{4(n-1)}{n} = \frac{4n^2 - 4(n-1)(n+1)}{n(n+1)} = \frac{4n^2 - 4n^2 + 4}{n(n+1)} = \frac{4}{n(n+1)}. The formula also gives a1=42=2a_1 = \frac{4}{2} = 2, so it holds for all n≥1n \ge 1. The sum is lim⁡sn=lim⁡4nn+1=lim⁡41+1/n=4\lim s_n = \lim \frac{4n}{n+1} = \lim \frac{4}{1 + 1/n} = 4. Note the direction: from sns_n back to ana_n is one subtraction, and the sum is read on sns_n directly, with no formula at all.

e) He has taken the limit of the wrong sequence. lim⁡an=lim⁡4n(n+1)=0\lim a_n = \lim \frac{4}{n(n+1)} = 0 says only that the terms become small; the sum is lim⁡sn=4\lim s_n = 4. Two sanity checks kill the answer 00 at once. First, every term is positive, so sn≥s1=2s_n \ge s_1 = 2 for all nn, and a limit of numbers all at least 22 is at least 22. Second, if a series converges, its terms ALWAYS tend to 00, so lim⁡an=0\lim a_n = 0 would be the sum of every convergent series, which is absurd. Two sequences live in every series question, (an)(a_n) and (sn)(s_n): name the one you are taking the limit of.

Exercise 2: Geometric series: read the first term and the ratio off the series

A geometric series is one in which each term is the previous one multiplied by the same number rr, the ratio. If its first term is a≠0a \ne 0, it converges exactly when ∣r∣<1|r| < 1, and then its sum is first term1−r\frac{\text{first term}}{1 - r}. It diverges when ∣r∣≥1|r| \ge 1.

The formula is the easy part. The marks are lost upstream: the first term is the term at the STARTING index, which is not always n=0n = 0, and the ratio is an+1an\frac{a_{n+1}}{a_n}, which is not always the number sitting under an exponent nn. For each series, write the first term and the ratio explicitly before concluding. No calculator.

  • a) ∑n=1∞4n5n−1\sum_{n=1}^{\infty} \frac{4^n}{5^{n-1}}
  • b) ∑n=2∞(−3)n+14n\sum_{n=2}^{\infty} \frac{(-3)^{n+1}}{4^n}
  • c) ∑n=0∞22n+13n\sum_{n=0}^{\infty} \frac{2^{2n+1}}{3^n}
  • d) ∑n=1∞2n+3n6n\sum_{n=1}^{\infty} \frac{2^n + 3^n}{6^n}, justifying why the series may be split in two.
  • e) ∑n=1∞e−2n\sum_{n=1}^{\infty} e^{-2n} and ∑n=1∞πn3n+1\sum_{n=1}^{\infty} \frac{\pi^n}{3^{n+1}}
Show the solution

Answers

  • a) First term 44, r=45r = \frac{4}{5}: converges to 2020.
  • b) First term −2716-\frac{27}{16}, r=−34r = -\frac{3}{4}: converges to −2728-\frac{27}{28}.
  • c) r=43>1r = \frac{4}{3} > 1: diverges.
  • d) 12+1=32\frac{1}{2} + 1 = \frac{3}{2}
  • e) 1e2−1\frac{1}{e^2 - 1}; the second diverges (r=π3>1r = \frac{\pi}{3} > 1).

a) Rewrite the term so that the exponents match: 4n5n−1=4⋅4n−15n−1=4(45)n−1\frac{4^n}{5^{n-1}} = 4 \cdot \frac{4^{n-1}}{5^{n-1}} = 4\left(\frac{4}{5}\right)^{n-1}. First term (n=1n = 1): 41=4\frac{4}{1} = 4. Ratio: an+1an=4n+15n⋅5n−14n=45\frac{a_{n+1}}{a_n} = \frac{4^{n+1}}{5^n} \cdot \frac{5^{n-1}}{4^n} = \frac{4}{5}. Since ∣r∣=45<1|r| = \frac{4}{5} < 1, the series converges and its sum is 41−4/5=41/5=20\frac{4}{1 - 4/5} = \frac{4}{1/5} = 20. The trap is to read r=45r = \frac{4}{5} correctly but take the first term to be 11 (as if the series were ∑(4/5)n\sum (4/5)^n from n=0n = 0), giving 55, a quarter of the answer.

b) The series starts at n=2n = 2, so the first term is a2=(−3)342=−2716a_2 = \frac{(-3)^3}{4^2} = -\frac{27}{16}. The ratio is (−3)n+24n+1⋅4n(−3)n+1=−34\frac{(-3)^{n+2}}{4^{n+1}} \cdot \frac{4^n}{(-3)^{n+1}} = -\frac{3}{4}. Since ∣r∣=34<1|r| = \frac{3}{4} < 1, it converges, to −27/161−(−3/4)=−27/167/4=−2716⋅47=−2728\frac{-27/16}{1 - (-3/4)} = \frac{-27/16}{7/4} = -\frac{27}{16} \cdot \frac{4}{7} = -\frac{27}{28}. Two signs to keep: the ratio is NEGATIVE, so 1−r=741 - r = \frac{7}{4}, not 14\frac{1}{4}; and the first term is negative because n+1=3n + 1 = 3 is odd. Quick check: a2+a3=−2716+8164=−2764a_2 + a_3 = -\frac{27}{16} + \frac{81}{64} = -\frac{27}{64}, and the sum −2728-\frac{27}{28} lies between a2a_2 and a2+a3a_2 + a_3, as it must for a series whose partial sums alternate around their limit.

c) 22n+1=2⋅4n2^{2n+1} = 2 \cdot 4^n, so the term is 2(43)n2\left(\frac{4}{3}\right)^n: the exponent 2n2n hides a ratio of 44, not 22. First term (n=0n = 0): 22. Ratio: 43\frac{4}{3}. Since ∣r∣=43≥1|r| = \frac{4}{3} \ge 1, the series diverges. The divergence test says the same thing independently: 2(43)n→∞2\left(\frac{4}{3}\right)^n \to \infty, so the terms do not tend to 00. Plugging into a1−r\frac{a}{1 - r} anyway gives 21−4/3=−6\frac{2}{1 - 4/3} = -6, a negative number for a sum of positive terms: the formula is valid ONLY when ∣r∣<1|r| < 1, and it does not warn you when you misuse it.

d) 2n+3n6n=(13)n+(12)n\frac{2^n + 3^n}{6^n} = \left(\frac{1}{3}\right)^n + \left(\frac{1}{2}\right)^n. Both ∑n=1∞(13)n\sum_{n=1}^{\infty} \left(\frac{1}{3}\right)^n and ∑n=1∞(12)n\sum_{n=1}^{\infty} \left(\frac{1}{2}\right)^n are geometric with ∣r∣<1|r| < 1, hence convergent, and the sum of two CONVERGENT series may be computed term by term: ∑(an+bn)=∑an+∑bn\sum (a_n + b_n) = \sum a_n + \sum b_n. So the sum is 1/31−1/3+1/21−1/2=12+1=32\frac{1/3}{1 - 1/3} + \frac{1/2}{1 - 1/2} = \frac{1}{2} + 1 = \frac{3}{2}. The justification is not decoration: splitting is legal because each piece converges, and it would be illegal if either one diverged (Exercise 7 shows what goes wrong then).

e) e−2n=(e−2)ne^{-2n} = \left(e^{-2}\right)^n: first term e−2e^{-2}, ratio e−2=1e2<1e^{-2} = \frac{1}{e^2} < 1 since e2>1e^2 > 1. The sum is e−21−e−2\frac{e^{-2}}{1 - e^{-2}}; multiplying top and bottom by e2e^2 gives 1e2−1\frac{1}{e^2 - 1}, the exact answer expected without a calculator. For the second series, πn3n+1=13(π3)n\frac{\pi^n}{3^{n+1}} = \frac{1}{3}\left(\frac{\pi}{3}\right)^n, ratio π3\frac{\pi}{3}. Deciding ∣r∣<1|r| < 1 or not needs no machine: π>3\pi > 3, so π3>1\frac{\pi}{3} > 1 and the series diverges. It looks harmless because π3\frac{\pi}{3} is close to 11, but a ratio just above 11 still makes the terms grow: (π3)n→∞\left(\frac{\pi}{3}\right)^n \to \infty.

Exercise 3: Telescoping series: partial fractions, then write out the partial sum

A telescoping series is one whose partial sum collapses because consecutive terms cancel. The cancellation is rarely visible in the series as printed: it appears after the term is rewritten as a DIFFERENCE, usually by partial fractions or a property of the logarithm. The method has three steps, and the marks follow them: rewrite ana_n as a difference, write sNs_N with enough terms to see what survives, take the limit of sNs_N.

For each series, decide convergence and give the sum when it exists.

  • a) ∑n=1∞1n(n+2)\sum_{n=1}^{\infty} \frac{1}{n(n+2)}
  • b) ∑n=1∞ln⁡nn+1\sum_{n=1}^{\infty} \ln\frac{n}{n+1}
  • c) ∑n=1∞(arctan⁡(n+1)−arctan⁡n)\sum_{n=1}^{\infty} \left(\arctan(n+1) - \arctan n\right)
  • d) ∑n=1∞2n+1n2(n+1)2\sum_{n=1}^{\infty} \frac{2n+1}{n^2(n+1)^2}, after checking that (n+1)2−n2=2n+1(n+1)^2 - n^2 = 2n + 1.
  • e) For the series of a), find the smallest NN for which sNs_N is within 1100\frac{1}{100} of the sum, using the exact remainder.
Show the solution

Answers

  • a) sN=12(32−1N+1−1N+2)s_N = \frac{1}{2}\left(\frac{3}{2} - \frac{1}{N+1} - \frac{1}{N+2}\right): converges to 34\frac{3}{4}.
  • b) sN=−ln⁡(N+1)→−∞s_N = -\ln(N+1) \to -\infty: diverges.
  • c) sN=arctan⁡(N+1)−π4s_N = \arctan(N+1) - \frac{\pi}{4}: converges to π4\frac{\pi}{4}.
  • d) ∑(1n2−1(n+1)2)=1\sum \left(\frac{1}{n^2} - \frac{1}{(n+1)^2}\right) = 1
  • e) N=99N = 99

a) Partial fractions: 1n(n+2)=An+Bn+2\frac{1}{n(n+2)} = \frac{A}{n} + \frac{B}{n+2}, so 1=A(n+2)+Bn1 = A(n+2) + Bn; n=0n = 0 gives A=12A = \frac{1}{2} and n=−2n = -2 gives B=−12B = -\frac{1}{2}. Thus an=12(1n−1n+2)a_n = \frac{1}{2}\left(\frac{1}{n} - \frac{1}{n+2}\right). Now write sNs_N with enough terms: sN=12[(1−13)+(12−14)+(13−15)+⋯+(1N−1−1N+1)+(1N−1N+2)]s_N = \frac{1}{2}\left[\left(1 - \frac{1}{3}\right) + \left(\frac{1}{2} - \frac{1}{4}\right) + \left(\frac{1}{3} - \frac{1}{5}\right) + \dots + \left(\frac{1}{N-1} - \frac{1}{N+1}\right) + \left(\frac{1}{N} - \frac{1}{N+2}\right)\right]. The gap is TWO, so each negative term cancels with a positive term two brackets later, and two terms survive at each end: sN=12(1+12−1N+1−1N+2)s_N = \frac{1}{2}\left(1 + \frac{1}{2} - \frac{1}{N+1} - \frac{1}{N+2}\right). As N→∞N \to \infty, sN→12⋅32=34s_N \to \frac{1}{2} \cdot \frac{3}{2} = \frac{3}{4}. Keeping only the 11 (as for a gap of one) gives 12\frac{1}{2}: writing three or four brackets is what shows how many terms survive.

b) ln⁡nn+1=ln⁡n−ln⁡(n+1)\ln\frac{n}{n+1} = \ln n - \ln(n+1). Then sN=(ln⁡1−ln⁡2)+(ln⁡2−ln⁡3)+⋯+(ln⁡N−ln⁡(N+1))=ln⁡1−ln⁡(N+1)=−ln⁡(N+1)s_N = (\ln 1 - \ln 2) + (\ln 2 - \ln 3) + \dots + (\ln N - \ln(N+1)) = \ln 1 - \ln(N+1) = -\ln(N+1). Since ln⁡(N+1)→∞\ln(N+1) \to \infty, sN→−∞s_N \to -\infty and the series DIVERGES. Yet its terms tend to ln⁡1=0\ln 1 = 0. Here is the chapter's central warning in its purest form: the cancellation is perfect, the terms vanish, and the sum is still infinite, because what survives in sNs_N is a quantity that does not have a finite limit.

c) sN=(arctan⁡2−arctan⁡1)+(arctan⁡3−arctan⁡2)+⋯+(arctan⁡(N+1)−arctan⁡N)=arctan⁡(N+1)−arctan⁡1s_N = (\arctan 2 - \arctan 1) + (\arctan 3 - \arctan 2) + \dots + (\arctan(N+1) - \arctan N) = \arctan(N+1) - \arctan 1. With arctan⁡1=π4\arctan 1 = \frac{\pi}{4} and arctan⁡(N+1)→π2\arctan(N+1) \to \frac{\pi}{2}, the series converges to π2−π4=π4\frac{\pi}{2} - \frac{\pi}{4} = \frac{\pi}{4}. Compare with b): same structure bn+1−bnb_{n+1} - b_n, opposite verdicts. The telescoping series ∑(bn+1−bn)\sum (b_{n+1} - b_n) converges exactly when (bn)(b_n) has a finite limit LL, and then its sum is L−b1L - b_1. Here bn=arctan⁡nb_n = \arctan n is bounded by π2\frac{\pi}{2}; in b), bn=−ln⁡nb_n = -\ln n is not.

d) (n+1)2−n2=n2+2n+1−n2=2n+1(n+1)^2 - n^2 = n^2 + 2n + 1 - n^2 = 2n + 1, so 2n+1n2(n+1)2=(n+1)2−n2n2(n+1)2=1n2−1(n+1)2\frac{2n+1}{n^2(n+1)^2} = \frac{(n+1)^2 - n^2}{n^2(n+1)^2} = \frac{1}{n^2} - \frac{1}{(n+1)^2}. This is the partial fraction decomposition obtained by recognition rather than by solving for constants; a full decomposition with An+Bn2+Cn+1+D(n+1)2\frac{A}{n} + \frac{B}{n^2} + \frac{C}{n+1} + \frac{D}{(n+1)^2} gives the same thing with A=C=0A = C = 0, at four times the cost. Then sN=1−1(N+1)2→1s_N = 1 - \frac{1}{(N+1)^2} \to 1: the series converges to 11. Check: a1=34a_1 = \frac{3}{4} and s1=1−14=34s_1 = 1 - \frac{1}{4} = \frac{3}{4}.

e) The remainder is exact here, not an estimate: 34−sN=12(1N+1+1N+2)\frac{3}{4} - s_N = \frac{1}{2}\left(\frac{1}{N+1} + \frac{1}{N+2}\right). We need 1N+1+1N+2<150\frac{1}{N+1} + \frac{1}{N+2} < \frac{1}{50}. For N=99N = 99: 1100+1101<1100+1100=150\frac{1}{100} + \frac{1}{101} < \frac{1}{100} + \frac{1}{100} = \frac{1}{50}, which works. For N=98N = 98: 199+1100>1100+1100=150\frac{1}{99} + \frac{1}{100} > \frac{1}{100} + \frac{1}{100} = \frac{1}{50}, which fails. And the remainder decreases with NN, so N=99N = 99 is the smallest. This is the privilege of a telescoping series: since sNs_N is known in closed form, the error is known exactly, and a question of precision becomes an inequality solved by hand.

Exercise 4: The divergence test: what it can say and what it cannot

The divergence test (the test for divergence, or nnth term test): if lim⁡n→∞an\lim_{n\to\infty} a_n does not exist, or exists and is not 00, then ∑an\sum a_n diverges. It comes from one line: if ∑an\sum a_n converges to ss, then an=sn−sn−1→s−s=0a_n = s_n - s_{n-1} \to s - s = 0.

The test has only one possible verdict, diverges. When lim⁡an=0\lim a_n = 0 it is SILENT, and a copy that concludes converges from it gets no marks. For each series, compute lim⁡an\lim a_n and state what the test says, and nothing more.

  • a) ∑n=1∞2n2−15n2+n\sum_{n=1}^{\infty} \frac{2n^2 - 1}{5n^2 + n}
  • b) ∑n=1∞nsin⁡1n\sum_{n=1}^{\infty} n \sin\frac{1}{n}
  • c) ∑n=1∞(1−2n)n\sum_{n=1}^{\infty} \left(1 - \frac{2}{n}\right)^n
  • d) ∑n=1∞cos⁡(nπ)\sum_{n=1}^{\infty} \cos(n\pi)
  • e) ∑n=1∞1n\sum_{n=1}^{\infty} \frac{1}{\sqrt{n}} and ∑n=1∞1n2+n\sum_{n=1}^{\infty} \frac{1}{n^2 + n}: apply the test to both, then settle each series by looking at its partial sums.
Show the solution

Answers

  • a) an→25≠0a_n \to \frac{2}{5} \ne 0: diverges.
  • b) an→1≠0a_n \to 1 \ne 0: diverges.
  • c) an→e−2≠0a_n \to e^{-2} \ne 0: diverges.
  • d) an=(−1)na_n = (-1)^n has no limit: diverges.
  • e) Test silent for both. sn≥ns_n \ge \sqrt{n}: the first diverges. sn=1−1n+1s_n = 1 - \frac{1}{n+1}: the second converges to 11.

a) Divide numerator and denominator by n2n^2: an=2−1/n25+1/n→25a_n = \frac{2 - 1/n^2}{5 + 1/n} \to \frac{2}{5}. Since 25≠0\frac{2}{5} \ne 0, the series diverges by the divergence test. The picture behind it: from some point on, every term is close to 0.40.4, so each new term adds about 0.40.4 to the partial sum, and sns_n grows roughly like 0.4n0.4n. A series cannot converge while adding a fixed amount at every step.

b) Set x=1nx = \frac{1}{n}: nsin⁡1n=sin⁡xxn\sin\frac{1}{n} = \frac{\sin x}{x} with x→0+x \to 0^+, and lim⁡x→0sin⁡xx=1\lim_{x\to 0} \frac{\sin x}{x} = 1. So an→1≠0a_n \to 1 \ne 0 and the series diverges. The trap is to see sin⁡1n→0\sin\frac{1}{n} \to 0 and stop there: the factor nn in front grows at exactly the rate needed to compensate. Always take the limit of the WHOLE term ana_n, never of a piece of it.

c) The limit (1+xn)n→ex\left(1 + \frac{x}{n}\right)^n \to e^x with x=−2x = -2 gives an→e−2a_n \to e^{-2}. To justify it, take the logarithm: nln⁡(1−2n)=ln⁡(1−2t)tn\ln\left(1 - \frac{2}{n}\right) = \frac{\ln(1 - 2t)}{t} with t=1n→0+t = \frac{1}{n} \to 0^+, a 00\frac{0}{0} form; L'Hôpital's rule on the function of tt gives −2/(1−2t)1→−2\frac{-2/(1 - 2t)}{1} \to -2, so an→e−2a_n \to e^{-2}. Since e−2≠0e^{-2} \ne 0 (an exponential is never 00), the series diverges. The classic slip: 1−2n→11 - \frac{2}{n} \to 1, so an→1n=1a_n \to 1^n = 1. The exponent grows with nn, so the limit of the base cannot be substituted; 1∞1^\infty is an indeterminate form. That slip happens to reach the right verdict here, but with a wrong limit, and the limit is what is marked.

d) cos⁡(nπ)=(−1)n\cos(n\pi) = (-1)^n: the terms are −1,1,−1,1,…-1, 1, -1, 1, \dots and lim⁡an\lim a_n does not exist. The test covers this case too: its hypothesis is that ana_n does not tend to 00, which includes having no limit at all. So the series diverges. Its partial sums are −1,0,−1,0,…-1, 0, -1, 0, \dots, which confirms it: they have no limit either.

e) For both series lim⁡an=0\lim a_n = 0, so the divergence test says NOTHING, and both verdicts must come from the partial sums. For ∑1n\sum \frac{1}{\sqrt{n}}: each of the nn terms of sns_n is at least the smallest one, 1n\frac{1}{\sqrt{n}}, so sn≥n⋅1n=n→∞s_n \ge n \cdot \frac{1}{\sqrt{n}} = \sqrt{n} \to \infty: the series diverges. For ∑1n2+n=∑(1n−1n+1)\sum \frac{1}{n^2 + n} = \sum \left(\frac{1}{n} - \frac{1}{n+1}\right): telescoping, sn=1−1n+1→1s_n = 1 - \frac{1}{n+1} \to 1, the series converges to 11. Same verdict from the test (silent), opposite outcomes: this is the whole meaning of the sentence the converse of the divergence test is false. Chapter 19 will give general tests for such series; here the partial sums were enough.

Exercise 5: The harmonic series: vanishing terms, unbounded sum

The harmonic series ∑n=1∞1n=1+12+13+…\sum_{n=1}^{\infty} \frac{1}{n} = 1 + \frac{1}{2} + \frac{1}{3} + \dots is the standard counterexample of the chapter: its terms tend to 00 and it diverges. This exercise proves it with nothing but its partial sums sns_n, by GROUPING terms in blocks that double in length, the argument given by Oresme in the fourteenth century.

The figure shows sns_n for n=1n = 1 to 3232 (filled dots) and the numbers 1+k21 + \frac{k}{2} placed at n=2kn = 2^k (open dots).

481216202428320.511.522.533.544.5sₙ = 1 + 1/2 + ... + 1/nopen dots: 1 + k/2 at n = 2ᵏn
  • a) Compute s1s_1, s2s_2, s4s_4 and s8s_8 exactly.
  • b) By grouping s2k=1+12+(13+14)+(15+⋯+18)+⋯+(12k−1+1+⋯+12k)s_{2^k} = 1 + \frac{1}{2} + \left(\frac{1}{3} + \frac{1}{4}\right) + \left(\frac{1}{5} + \dots + \frac{1}{8}\right) + \dots + \left(\frac{1}{2^{k-1}+1} + \dots + \frac{1}{2^k}\right), show that s2k≥1+k2s_{2^k} \ge 1 + \frac{k}{2}.
  • c) Conclude that the harmonic series diverges. Why is it enough to control sns_n only at n=2kn = 2^k?
  • d) By grouping the other way, show that s2k−1≤ks_{2^k - 1} \le k. Deduce that sn≤10s_n \le 10 for every n≤1023n \le 1023, and give an nn from b) for which sn>10s_n > 10 is guaranteed.
  • e) A student adds the first thousand terms on a computer, sees s1000s_{1000} under 7.57.5 and growing by less than 0.0010.001 per term, and concludes that the series converges. What is wrong with this reasoning?
Show the solution

Answers

  • a) s1=1s_1 = 1, s2=32s_2 = \frac{3}{2}, s4=2512s_4 = \frac{25}{12}, s8=761280s_8 = \frac{761}{280}
  • b) Each block holds 2j−12^{j-1} terms, each ≥12j\ge \frac{1}{2^j}: block ≥12\ge \frac{1}{2}, so s2k≥1+k2s_{2^k} \ge 1 + \frac{k}{2}.
  • c) (sn)(s_n) increases and is unbounded, so sn→∞s_n \to \infty: diverges.
  • d) s1023≤10s_{1023} \le 10; s218>10s_{2^{18}} > 10, that is n=262 144n = 262\,144.
  • e) Small increments prove nothing: sns_n passes 1010, then 100100, just very slowly.

a) s1=1s_1 = 1, s2=32s_2 = \frac{3}{2}, s4=32+13+14=18+4+312=2512s_4 = \frac{3}{2} + \frac{1}{3} + \frac{1}{4} = \frac{18 + 4 + 3}{12} = \frac{25}{12}, s8=2512+15+16+17+18s_8 = \frac{25}{12} + \frac{1}{5} + \frac{1}{6} + \frac{1}{7} + \frac{1}{8}. Over the common denominator 840840: 1750+168+140+120+105840=2283840=761280\frac{1750 + 168 + 140 + 120 + 105}{840} = \frac{2283}{840} = \frac{761}{280}, a little under 2.722.72. Compare with b): 1+02=11 + \frac{0}{2} = 1, 1+121 + \frac{1}{2}, 1+22=2<25121 + \frac{2}{2} = 2 < \frac{25}{12} and 1+32=52<7612801 + \frac{3}{2} = \frac{5}{2} < \frac{761}{280}. The bound holds and is not far off, which the figure shows: the open dots sit just under the filled ones.

b) The jjth block runs from 12j−1+1\frac{1}{2^{j-1}+1} to 12j\frac{1}{2^j}: it holds 2j−2j−1=2j−12^j - 2^{j-1} = 2^{j-1} terms, and the smallest of them is the last one, 12j\frac{1}{2^j}. So the block is at least 2j−1⋅12j=122^{j-1} \cdot \frac{1}{2^j} = \frac{1}{2}. For instance 13+14≥14+14=12\frac{1}{3} + \frac{1}{4} \ge \frac{1}{4} + \frac{1}{4} = \frac{1}{2} and 15+⋯+18≥4⋅18=12\frac{1}{5} + \dots + \frac{1}{8} \ge 4 \cdot \frac{1}{8} = \frac{1}{2}. The sum s2ks_{2^k} is 11, plus 12\frac{1}{2}, plus k−1k - 1 blocks (j=2j = 2 to kk), so s2k≥1+12+k−12=1+k2s_{2^k} \ge 1 + \frac{1}{2} + \frac{k-1}{2} = 1 + \frac{k}{2}. The gesture is to bound a whole block by its number of terms times its smallest term, which is the same gesture as sn≥ns_n \ge \sqrt{n} in Exercise 4.

c) Every term is positive, so (sn)(s_n) is increasing. By b), s2k≥1+k2s_{2^k} \ge 1 + \frac{k}{2} exceeds any given number MM once k>2Mk > 2M. An increasing sequence that exceeds every MM at some index stays above MM afterwards, so sn→∞s_n \to \infty and the harmonic series diverges. Controlling sns_n at n=2kn = 2^k only is enough precisely because sns_n is increasing: between two powers of 22 it cannot fall back. Without that monotonicity, a subsequence tending to infinity would still prove divergence, but not divergence to ∞\infty.

d) Now group from 12j\frac{1}{2^j} to 12j+1−1\frac{1}{2^{j+1}-1}: 2j2^j terms, the LARGEST being 12j\frac{1}{2^j}, so each block is at most 2j⋅12j=12^j \cdot \frac{1}{2^j} = 1. The blocks j=0,1,…,k−1j = 0, 1, \dots, k-1 make up exactly s2k−1s_{2^k - 1}, so s2k−1≤ks_{2^k - 1} \le k. With k=10k = 10: s1023≤10s_{1023} \le 10, and since (sn)(s_n) increases, sn≤10s_n \le 10 for every n≤1023n \le 1023. From b) with k=18k = 18: s218≥1+9=10s_{2^{18}} \ge 1 + 9 = 10, and the inequality is strict because the blocks from j=2j = 2 on are strictly larger than 12\frac{1}{2} (their terms are not all equal). So n=218=262 144n = 2^{18} = 262\,144 guarantees sn>10s_n > 10. The true first nn lies between these two bounds (it is 12 36712\,367), and the two groupings squeeze s2ks_{2^k} between 1+k21 + \frac{k}{2} and k+1k + 1.

e) A small increment does not mean a finite total. From n=1000n = 1000 on each term is below 0.0010.001, but there are infinitely many of them, and d) shows that the sum still passes 1010 (between n=1024n = 1024 and n=262 144n = 262\,144), then 100100, then any number; it simply takes astronomically many terms, since doubling nn adds only about 12\frac{1}{2} or more. A computer adding terms can suggest a convergence that does not happen, and it can never prove one. The verdict comes from an argument on sns_n, as in b) and c), never from a table of values: this is exactly why the harmonic series is the example every exam uses to test the false converse of the divergence test.

Part B: problems and reasoning (/50)

Exercise 6: Repeating decimals are geometric series

A repeating decimal is an infinite sum in disguise: 0.36‾=0.363636…=36100+361002+361003+…0.\overline{36} = 0.363636\ldots = \frac{36}{100} + \frac{36}{100^2} + \frac{36}{100^3} + \dots, a geometric series whose ratio is 10−p10^{-p}, with pp the length of the repeating block.

Give every answer as a fraction in lowest terms, identifying the first term and the ratio each time. No calculator: the checks are done by multiplying back.

  • a) 0.36‾0.\overline{36}
  • b) 2.317‾=2.3171717…2.3\overline{17} = 2.3171717\ldots (only the block 1717 repeats).
  • c) 0.9‾0.\overline{9}. A student claims that 0.999…0.999\ldots is the largest number less than 11. Answer him with the series.
  • d) 1.142857‾1.\overline{142857}, knowing that 7×142 857=999 9997 \times 142\,857 = 999\,999.
  • e) Show that 0.d1d2…dp‾=B10p−10.\overline{d_1 d_2 \ldots d_p} = \frac{B}{10^p - 1}, where BB is the whole number written d1d2…dpd_1 d_2 \ldots d_p. Why does this prove that every repeating decimal is a rational number?
Show the solution

Answers

  • a) 36/1001−1/100=3699=411\frac{36/100}{1 - 1/100} = \frac{36}{99} = \frac{4}{11}
  • b) 2310+17990=1147495\frac{23}{10} + \frac{17}{990} = \frac{1147}{495}
  • c) 9/101−1/10=1\frac{9/10}{1 - 1/10} = 1: 0.9‾0.\overline{9} IS 11.
  • d) 1+142857999999=1+17=871 + \frac{142857}{999999} = 1 + \frac{1}{7} = \frac{8}{7}
  • e) First term B10p\frac{B}{10^p}, ratio 110p\frac{1}{10^p}: sum B10p−1\frac{B}{10^p - 1}, a quotient of integers.

a) First term 36100\frac{36}{100}, ratio 1100\frac{1}{100} (the block has p=2p = 2 digits, so each copy sits two places further right). Since ∣r∣<1|r| < 1: 0.36‾=36/1001−1/100=36/10099/100=3699=4110.\overline{36} = \frac{36/100}{1 - 1/100} = \frac{36/100}{99/100} = \frac{36}{99} = \frac{4}{11}. Check by long division: 4÷11=0.3636…4 \div 11 = 0.3636\ldots, since 40=3×11+740 = 3 \times 11 + 7 and 70=6×11+470 = 6 \times 11 + 4, back to 4040. The ratio is 1100\frac{1}{100}, not 110\frac{1}{10}: taking 110\frac{1}{10} would describe 0.363636…0.363636\ldots as 0.36+0.036+…0.36 + 0.036 + \dots, which is a different number.

b) Separate the part that does not repeat: 2.317‾=2.3+0.0171717…2.3\overline{17} = 2.3 + 0.0171717\ldots. The repeating part has first term 171000\frac{17}{1000} and ratio 1100\frac{1}{100}, so it equals 17/100099/100=17990\frac{17/1000}{99/100} = \frac{17}{990}. Then 2.317‾=2310+17990=2277990+17990=2294990=11474952.3\overline{17} = \frac{23}{10} + \frac{17}{990} = \frac{2277}{990} + \frac{17}{990} = \frac{2294}{990} = \frac{1147}{495} (dividing by 22; 1147=31×371147 = 31 \times 37 and 495=5×9×11495 = 5 \times 9 \times 11 share no factor). The trap is the first term: the block 1717 starts in the second decimal place, so its first copy is 171000\frac{17}{1000}, not 17100\frac{17}{100}. Check: 495×2.3171717…495 \times 2.3171717\ldots: 495×2.3=1138.5495 \times 2.3 = 1138.5 and 495×17990=8.5495 \times \frac{17}{990} = 8.5, total 11471147.

c) 0.9‾=910+9100+…0.\overline{9} = \frac{9}{10} + \frac{9}{100} + \dots, first term 910\frac{9}{10}, ratio 110\frac{1}{10}, sum 9/109/10=1\frac{9/10}{9/10} = 1. So 0.999…=10.999\ldots = 1 exactly: two decimal expansions, one number. The student is confusing the partial sums with the sum. Every partial sum 0.99…90.99\ldots9 (nn nines) equals 1−10−n1 - 10^{-n} and is indeed less than 11, but the series is the LIMIT of these partial sums, and that limit is 11. There is, moreover, no largest number less than 11: if x<1x < 1, then x+12\frac{x + 1}{2} lies strictly between xx and 11.

d) 1.142857‾=1+142857106+1428571012+…1.\overline{142857} = 1 + \frac{142857}{10^6} + \frac{142857}{10^{12}} + \dots. The repeating part has first term 142857106\frac{142857}{10^6} and ratio 10−610^{-6}, so it equals 142857106−1=142857999999=17\frac{142857}{10^6 - 1} = \frac{142857}{999999} = \frac{1}{7}, since 999 999=7×142 857999\,999 = 7 \times 142\,857. Hence 1.142857‾=871.\overline{142857} = \frac{8}{7}. The given product is the whole point: without a calculator, simplifying 142857999999\frac{142857}{999999} from scratch is long, and the statement hands you the factor to look for.

e) The block BB repeats every pp places: 0.d1…dp‾=B10p+B102p+…0.\overline{d_1 \ldots d_p} = \frac{B}{10^p} + \frac{B}{10^{2p}} + \dots, geometric with first term B10p\frac{B}{10^p} and ratio 110p<1\frac{1}{10^p} < 1. Its sum is B/10p1−1/10p=B10p−1\frac{B/10^p}{1 - 1/10^p} = \frac{B}{10^p - 1}, and a) is the case B=36B = 36, p=2p = 2. A general repeating decimal is a terminating decimal (a fraction with denominator a power of 1010) plus such a block shifted by a power of 1010, as in b); sums and quotients of fractions are fractions, so every repeating decimal is rational. The series did all the work: an infinite expansion was converted into a finite quotient because the ratio 10−p10^{-p} is less than 11.

Exercise 7: Harder telescoping: three factors, factorials and logarithms

On a final, the telescoping series is rarely ∑1n(n+1)\sum \frac{1}{n(n+1)}. The difference has to be FOUND: a three-factor denominator, a factorial, a logarithm of a product. And one rule governs every manipulation: a series may be split into several series only when each of them converges; before that, all the work is done on the FINITE partial sum sNs_N, where every rearrangement is legal.

  • a) Show that 1n(n+1)(n+2)=12[1n(n+1)−1(n+1)(n+2)]\frac{1}{n(n+1)(n+2)} = \frac{1}{2}\left[\frac{1}{n(n+1)} - \frac{1}{(n+1)(n+2)}\right] and deduce ∑n=1∞1n(n+1)(n+2)\sum_{n=1}^{\infty} \frac{1}{n(n+1)(n+2)}.
  • b) The partial fraction decomposition is 1n(n+1)(n+2)=12n−1n+1+12(n+2)\frac{1}{n(n+1)(n+2)} = \frac{1}{2n} - \frac{1}{n+1} + \frac{1}{2(n+2)}. A student writes the sum as 12∑1n−∑1n+1+12∑1n+2\frac{1}{2}\sum \frac{1}{n} - \sum \frac{1}{n+1} + \frac{1}{2}\sum \frac{1}{n+2}. Why is this not allowed? Redo the computation correctly with this decomposition, on sNs_N.
  • c) ∑n=1∞n(n+1)!\sum_{n=1}^{\infty} \frac{n}{(n+1)!}, by writing n=(n+1)−1n = (n+1) - 1.
  • d) ∑n=2∞ln⁡(1−1n2)\sum_{n=2}^{\infty} \ln\left(1 - \frac{1}{n^2}\right)
  • e) ∑n=1∞(n+1−n)\sum_{n=1}^{\infty} \left(\sqrt{n+1} - \sqrt{n}\right): find sNs_N, decide, and compute lim⁡an\lim a_n.
Show the solution

Answers

  • a) sN=12[12−1(N+1)(N+2)]→14s_N = \frac{1}{2}\left[\frac{1}{2} - \frac{1}{(N+1)(N+2)}\right] \to \frac{1}{4}
  • b) Each piece diverges (∞−∞\infty - \infty). On sNs_N: sN=14−12(N+1)+12(N+2)→14s_N = \frac{1}{4} - \frac{1}{2(N+1)} + \frac{1}{2(N+2)} \to \frac{1}{4}.
  • c) ∑(1n!−1(n+1)!)=1\sum \left(\frac{1}{n!} - \frac{1}{(n+1)!}\right) = 1
  • d) sN=ln⁡N+12N→−ln⁡2s_N = \ln\frac{N+1}{2N} \to -\ln 2
  • e) sN=N+1−1→∞s_N = \sqrt{N+1} - 1 \to \infty: diverges, although an=1n+1+n→0a_n = \frac{1}{\sqrt{n+1} + \sqrt{n}} \to 0.

a) Put the bracket over a common denominator: 1n(n+1)−1(n+1)(n+2)=(n+2)−nn(n+1)(n+2)=2n(n+1)(n+2)\frac{1}{n(n+1)} - \frac{1}{(n+1)(n+2)} = \frac{(n+2) - n}{n(n+1)(n+2)} = \frac{2}{n(n+1)(n+2)}; half of it is the term. So an=12(bn−bn+1)a_n = \frac{1}{2}(b_n - b_{n+1}) with bn=1n(n+1)b_n = \frac{1}{n(n+1)}, and sN=12(b1−bN+1)=12[12−1(N+1)(N+2)]s_N = \frac{1}{2}(b_1 - b_{N+1}) = \frac{1}{2}\left[\frac{1}{2} - \frac{1}{(N+1)(N+2)}\right]. As N→∞N \to \infty, sN→14s_N \to \frac{1}{4}. Check: a1=16a_1 = \frac{1}{6} and s1=12(12−16)=16s_1 = \frac{1}{2}\left(\frac{1}{2} - \frac{1}{6}\right) = \frac{1}{6}. The whole trick is to see a difference of CONSECUTIVE values of one sequence bnb_n; once seen, the gap is one and a single term survives.

b) Each of ∑1n\sum \frac{1}{n}, ∑1n+1\sum \frac{1}{n+1}, ∑1n+2\sum \frac{1}{n+2} is a harmonic series with terms removed, so each diverges to ∞\infty, and the student's expression is ∞−∞+∞\infty - \infty + \infty, which has no value. The rule ∑(an+bn)=∑an+∑bn\sum(a_n + b_n) = \sum a_n + \sum b_n requires both series on the right to converge. The correct route writes the FINITE sums: with HN=1+12+⋯+1NH_N = 1 + \frac{1}{2} + \dots + \frac{1}{N}, sN=12HN−(HN+1−1)+12(HN+2−1−12)s_N = \frac{1}{2}H_N - (H_{N+1} - 1) + \frac{1}{2}\left(H_{N+2} - 1 - \frac{1}{2}\right). Replace HN+1=HN+1N+1H_{N+1} = H_N + \frac{1}{N+1} and HN+2=HN+1N+1+1N+2H_{N+2} = H_N + \frac{1}{N+1} + \frac{1}{N+2}: the HNH_N cancel (12−1+12=0\frac{1}{2} - 1 + \frac{1}{2} = 0), leaving sN=1−34−1N+1+12(N+1)+12(N+2)=14−12(N+1)+12(N+2)→14s_N = 1 - \frac{3}{4} - \frac{1}{N+1} + \frac{1}{2(N+1)} + \frac{1}{2(N+2)} = \frac{1}{4} - \frac{1}{2(N+1)} + \frac{1}{2(N+2)} \to \frac{1}{4}. Same answer as a), as it must be, and the cancellation of the divergent parts happened INSIDE a finite sum, where it is legitimate.

c) n(n+1)!=(n+1)−1(n+1)!=n+1(n+1)!−1(n+1)!=1n!−1(n+1)!\frac{n}{(n+1)!} = \frac{(n+1) - 1}{(n+1)!} = \frac{n+1}{(n+1)!} - \frac{1}{(n+1)!} = \frac{1}{n!} - \frac{1}{(n+1)!}, using (n+1)!=(n+1)⋅n!(n+1)! = (n+1) \cdot n!. Then sN=(11!−12!)+(12!−13!)+⋯+(1N!−1(N+1)!)=1−1(N+1)!→1s_N = \left(\frac{1}{1!} - \frac{1}{2!}\right) + \left(\frac{1}{2!} - \frac{1}{3!}\right) + \dots + \left(\frac{1}{N!} - \frac{1}{(N+1)!}\right) = 1 - \frac{1}{(N+1)!} \to 1. The series converges to 11. Check: a1=12a_1 = \frac{1}{2}, a2=26=13a_2 = \frac{2}{6} = \frac{1}{3}, s2=56=1−13!s_2 = \frac{5}{6} = 1 - \frac{1}{3!}. The writing n=(n+1)−1n = (n+1) - 1 is the factorial version of partial fractions: make the numerator look like a factor of the denominator.

d) 1−1n2=(n−1)(n+1)n21 - \frac{1}{n^2} = \frac{(n-1)(n+1)}{n^2}, so an=ln⁡n−1n+ln⁡n+1na_n = \ln\frac{n-1}{n} + \ln\frac{n+1}{n}: two telescoping pieces, each divergent on its own. On sNs_N, from n=2n = 2 to NN: ∑n=2Nln⁡n−1n=ln⁡1N\sum_{n=2}^{N} \ln\frac{n-1}{n} = \ln\frac{1}{N} (the logarithms of 1,2,…1, 2, \dots cancel in chain) and ∑n=2Nln⁡n+1n=ln⁡N+12\sum_{n=2}^{N} \ln\frac{n+1}{n} = \ln\frac{N+1}{2}. So sN=ln⁡1N+ln⁡N+12=ln⁡N+12Ns_N = \ln\frac{1}{N} + \ln\frac{N+1}{2} = \ln\frac{N+1}{2N}. As N→∞N \to \infty, N+12N→12\frac{N+1}{2N} \to \frac{1}{2} and, ln⁡\ln being continuous, sN→ln⁡12=−ln⁡2s_N \to \ln\frac{1}{2} = -\ln 2. The series converges to −ln⁡2-\ln 2; every term is negative, and so is the sum. Check: s2=ln⁡34s_2 = \ln\frac{3}{4}, the first term.

e) sN=(2−1)+(3−2)+⋯+(N+1−N)=N+1−1→∞s_N = (\sqrt{2} - \sqrt{1}) + (\sqrt{3} - \sqrt{2}) + \dots + (\sqrt{N+1} - \sqrt{N}) = \sqrt{N+1} - 1 \to \infty: the series diverges. Yet, multiplying by the conjugate, an=(n+1)−nn+1+n=1n+1+n→0a_n = \frac{(n+1) - n}{\sqrt{n+1} + \sqrt{n}} = \frac{1}{\sqrt{n+1} + \sqrt{n}} \to 0. It is the same lesson as ∑ln⁡nn+1\sum \ln\frac{n}{n+1} in Exercise 3: a perfect telescoping, terms that vanish, and a divergent series, because the surviving quantity N+1\sqrt{N+1} has no finite limit. A telescoping series is never convergent BECAUSE it telescopes; it converges when what survives in sNs_N has a limit.

Exercise 8: Five statements to correct

Each statement below was written on a MATH 141 paper, and each is false. Say what is wrong, give a correct statement, and settle it with a partial sum or a counterexample.

  • a) Since lim⁡n→∞ln⁡n+1n=0\lim_{n\to\infty} \ln\frac{n+1}{n} = 0, the series ∑n=1∞ln⁡n+1n\sum_{n=1}^{\infty} \ln\frac{n+1}{n} converges.
  • b) ∑n=1∞(23)n=11−2/3=3\sum_{n=1}^{\infty} \left(\frac{2}{3}\right)^n = \frac{1}{1 - 2/3} = 3.
  • c) ∑n=1∞(1n−1n+1)=∑1n−∑1n+1\sum_{n=1}^{\infty} \left(\frac{1}{n} - \frac{1}{n+1}\right) = \sum \frac{1}{n} - \sum \frac{1}{n+1} is a difference of two divergent series, so it diverges.
  • d) If ∑an\sum a_n and ∑bn\sum b_n both diverge, then ∑(an+bn)\sum (a_n + b_n) diverges.
  • e) 1−1+1−1+⋯=(1−1)+(1−1)+⋯=0+0+⋯=01 - 1 + 1 - 1 + \dots = (1 - 1) + (1 - 1) + \dots = 0 + 0 + \dots = 0.
Show the solution

Answers

  • a) False: sN=ln⁡(N+1)→∞s_N = \ln(N+1) \to \infty, the series diverges.
  • b) False: the first term is 23\frac{2}{3}, the sum is 22.
  • c) False: sN=1−1N+1→1s_N = 1 - \frac{1}{N+1} \to 1; splitting was illegal.
  • d) False: an=1a_n = 1, bn=−1b_n = -1 give ∑0=0\sum 0 = 0.
  • e) False: sn=1,0,1,0,…s_n = 1, 0, 1, 0, \dots has no limit; the series diverges.

a) FALSE. lim⁡an=0\lim a_n = 0 is necessary for convergence, never sufficient: the divergence test is silent here. The partial sums decide: ln⁡n+1n=ln⁡(n+1)−ln⁡n\ln\frac{n+1}{n} = \ln(n+1) - \ln n, so sN=ln⁡(N+1)−ln⁡1=ln⁡(N+1)→∞s_N = \ln(N+1) - \ln 1 = \ln(N+1) \to \infty, and the series diverges. Correct statement: if lim⁡an≠0\lim a_n \ne 0 the series diverges; if lim⁡an=0\lim a_n = 0, nothing can be concluded from that alone. This series is the mirror image of ∑ln⁡nn+1\sum \ln\frac{n}{n+1} in Exercise 3, which goes to −∞-\infty.

b) FALSE. 11−r\frac{1}{1 - r} is the sum of 1+r+r2+…1 + r + r^2 + \dots, a series whose FIRST TERM is 11, that is starting at n=0n = 0. Here the series starts at n=1n = 1, its first term is 23\frac{2}{3}, and the sum is 2/31−2/3=2\frac{2/3}{1 - 2/3} = 2. Equivalently, 33 is the sum from n=0n = 0, and removing the term (23)0=1\left(\frac{2}{3}\right)^0 = 1 leaves 22. Check: s1=23s_1 = \frac{2}{3}, s2=109s_2 = \frac{10}{9}, s3=3827s_3 = \frac{38}{27}, all well under 22 and climbing towards it. Correct statement: a convergent geometric series equals its first term divided by 1−r1 - r.

c) FALSE, twice. First, ∑(an−bn)=∑an−∑bn\sum(a_n - b_n) = \sum a_n - \sum b_n is valid only when both series on the right converge; with two divergent series, the right side is ∞−∞\infty - \infty, which has no value and allows no conclusion, neither converges nor diverges. Second, the partial sums settle it: sN=1−1N+1→1s_N = 1 - \frac{1}{N+1} \to 1, so the series converges to 11. Correct statement: a telescoping series is handled on its partial sum sNs_N, a finite sum where cancelling is legitimate, and never by splitting into two infinite series.

d) FALSE. Take an=1a_n = 1 and bn=−1b_n = -1: ∑1\sum 1 and ∑(−1)\sum(-1) diverge (terms not tending to 00), but an+bn=0a_n + b_n = 0 and ∑0=0\sum 0 = 0 converges. What IS true is the mixed case: if ∑an\sum a_n converges and ∑bn\sum b_n diverges, then ∑(an+bn)\sum(a_n + b_n) diverges, since otherwise ∑bn=∑(an+bn)−∑an\sum b_n = \sum(a_n + b_n) - \sum a_n would be a difference of two convergent series, hence convergent. Correct statement: convergent plus divergent is divergent; divergent plus divergent can go either way.

e) FALSE. The series is ∑n=1∞(−1)n+1\sum_{n=1}^{\infty} (-1)^{n+1}, whose terms do not tend to 00: it diverges by the divergence test, and it is also a geometric series with r=−1r = -1, ∣r∣≥1|r| \ge 1. Its partial sums are s1=1s_1 = 1, s2=0s_2 = 0, s3=1s_3 = 1, s4=0,…s_4 = 0, \dots (figure of the solution), which have no limit. Inserting brackets replaces (sn)(s_n) by the subsequence s2,s4,s6,…s_2, s_4, s_6, \dots, all equal to 00, and grouping differently, 1+(−1+1)+(−1+1)+…1 + (-1 + 1) + (-1 + 1) + \dots, would give 11. Correct statement: brackets may be inserted in a CONVERGENT series without changing its sum; in a divergent one, grouping can manufacture any of several values, which is the proof that they mean nothing.

1234567891011-0.50.511.5sₙ jumps between 1 and 0n

Exercise 9: Repeated doses of a medication: the level the doses approach

A patient takes a 100100 mg tablet every 1212 hours. The body eliminates the drug with a half-life of 66 hours, so over the 1212 hours between two tablets the amount in the body is multiplied by (12)2=14\left(\frac{1}{2}\right)^2 = \frac{1}{4}. Let QnQ_n be the amount just AFTER the nnth tablet, so that Q1=100Q_1 = 100 mg.

The figure shows the first 4848 hours: each tablet adds 100100 mg on top of what is left, and the peaks Q1,Q2,Q3,Q4Q_1, Q_2, Q_3, Q_4 rise less and less. Exact answers, no calculator.

12243648255075100125150Q₁Q₂Q₃Q₄t (hours)mg
  • a) Compute Q2Q_2, Q3Q_3 and Q4Q_4, and show that Qn=100(1+14+⋯+(14)n−1)Q_n = 100\left(1 + \frac{1}{4} + \dots + \left(\frac{1}{4}\right)^{n-1}\right).
  • b) Give QnQ_n in closed form and check it on Q2Q_2.
  • c) Find the long-run peak lim⁡Qn\lim Q_n and the long-run trough, the amount just before a tablet. Can QnQ_n ever reach the long-run peak?
  • d) The safe maximum amount in the body is 200200 mg. What is the largest dose DD (every 1212 hours) whose long-run peak stays within it? Alternatively, keeping 100100 mg, what are the long-run peak and trough if the tablet is taken every 66 hours?
  • e) With the original schedule, after how many tablets does the peak first exceed 95%95\% of its long-run value?
Show the solution

Answers

  • a) Q2=125Q_2 = 125, Q3=5254=131.25Q_3 = \frac{525}{4} = 131.25, Q4=212516Q_4 = \frac{2125}{16} mg; Qn+1=14Qn+100Q_{n+1} = \frac{1}{4}Q_n + 100.
  • b) Qn=4003(1−4−n)Q_n = \frac{400}{3}\left(1 - 4^{-n}\right); Q2=4003⋅1516=125Q_2 = \frac{400}{3} \cdot \frac{15}{16} = 125.
  • c) Peak 4003≈133\frac{400}{3} \approx 133 mg, trough 1003≈33\frac{100}{3} \approx 33 mg; never reached, Qn<4003Q_n < \frac{400}{3}.
  • d) D=150D = 150 mg. Every 66 h: peak 200200 mg, trough 100100 mg.
  • e) n=3n = 3 (4n>204^n > 20).

a) Just before tablet n+1n+1, a quarter of QnQ_n is left, and the tablet adds 100100: Qn+1=14Qn+100Q_{n+1} = \frac{1}{4}Q_n + 100. So Q2=25+100=125Q_2 = 25 + 100 = 125, Q3=1254+100=5254=131.25Q_3 = \frac{125}{4} + 100 = \frac{525}{4} = 131.25, Q4=52516+100=212516≈132.8Q_4 = \frac{525}{16} + 100 = \frac{2125}{16} \approx 132.8 mg. Unrolling the recurrence shows where each milligram comes from: the latest tablet contributes 100100, the one before 100⋅14100 \cdot \frac{1}{4}, the one before that 100⋅(14)2100 \cdot \left(\frac{1}{4}\right)^2, and the first one 100(14)n−1100\left(\frac{1}{4}\right)^{n-1}. Hence Qn=100(1+14+⋯+(14)n−1)Q_n = 100\left(1 + \frac{1}{4} + \dots + \left(\frac{1}{4}\right)^{n-1}\right), a partial sum of a geometric series with first term 100100 and ratio 14\frac{1}{4}.

b) The finite geometric sum with nn terms is first term⋅1−rn1−r\text{first term} \cdot \frac{1 - r^n}{1 - r}: Qn=100⋅1−(1/4)n3/4=4003(1−14n)Q_n = 100 \cdot \frac{1 - (1/4)^n}{3/4} = \frac{400}{3}\left(1 - \frac{1}{4^n}\right). Check: Q2=4003⋅1516=600048=125Q_2 = \frac{400}{3} \cdot \frac{15}{16} = \frac{6000}{48} = 125. Count the terms: the sum runs from the exponent 00 to n−1n - 1, which is nn terms, hence rnr^n and not rn−1r^{n-1} in the formula. Checking one value is the fastest way to catch that off-by-one.

c) QnQ_n is the nnth partial sum of ∑k=0∞100(14)k\sum_{k=0}^{\infty} 100\left(\frac{1}{4}\right)^k, which converges since 14<1\frac{1}{4} < 1: lim⁡Qn=1001−1/4=4003≈133.3\lim Q_n = \frac{100}{1 - 1/4} = \frac{400}{3} \approx 133.3 mg (using 4003=133.33…\frac{400}{3} = 133.33\ldots). The trough is a quarter of the peak: 1003≈33.3\frac{100}{3} \approx 33.3 mg. The peak is never reached, since Qn=4003(1−4−n)<4003Q_n = \frac{400}{3}(1 - 4^{-n}) < \frac{400}{3} for every nn: the steady state is a LIMIT, like the sum of any series, approached from below. The clinical meaning: taking the tablets regularly never makes the level climb without bound, because the amount eliminated between two tablets grows with the amount present.

d) With a dose DD the same computation gives a long-run peak D1−1/4=4D3\frac{D}{1 - 1/4} = \frac{4D}{3}. We need 4D3≤200\frac{4D}{3} \le 200, so D≤150D \le 150: the largest dose is 150150 mg. Keeping 100100 mg every 66 hours, one half-life passes between tablets, so the ratio becomes 12\frac{1}{2} and the peak tends to 1001−1/2=200\frac{100}{1 - 1/2} = 200 mg, with a trough of 100100 mg. The two changes are not equivalent: halving the interval doubles the trough (from 3333 to 100100 mg), which matters when the drug must stay above an effective level; raising the dose to 150150 mg only brings the trough to 5050 mg.

e) Qn400/3=1−14n>95100\frac{Q_n}{400/3} = 1 - \frac{1}{4^n} > \frac{95}{100} exactly when 14n<120\frac{1}{4^n} < \frac{1}{20}, that is 4n>204^n > 20. Since 42=16<20<64=434^2 = 16 < 20 < 64 = 4^3, the first nn is 33: Q3400/3=6364\frac{Q_3}{400/3} = \frac{63}{64}, about 98%98\%, while Q2400/3=1516\frac{Q_2}{400/3} = \frac{15}{16}, about 94%94\%. No logarithm and no calculator needed: when the ratio is a simple fraction, the inequality is settled by listing powers. In practice, the steady state is reached after a few dosing intervals, and the geometric ratio is what says how few.

Exercise 10: The Koch snowflake: infinite perimeter, finite area

Start from an equilateral triangle of side 11 (step 00). At each step, every side is cut into three equal thirds, and the middle third is replaced by the two other sides of an equilateral triangle built outward on it. The figure shows steps 00, 11 and 22; the snowflake is what the figure becomes as the steps go on forever.

Recall that an equilateral triangle of side ℓ\ell has area 34ℓ2\frac{\sqrt{3}}{4}\ell^2. Exact answers.

step 0step 1step 2
  • a) Let NkN_k be the number of sides and ℓk\ell_k their length after step kk. Find NkN_k, ℓk\ell_k and the perimeter PkP_k.
  • b) What happens to PkP_k as k→∞k \to \infty? Write PkP_k as a partial sum of a series of perimeter increments and identify that series.
  • c) Show that the area added at step k≥1k \ge 1 is 312(49)k−1\frac{\sqrt{3}}{12}\left(\frac{4}{9}\right)^{k-1}.
  • d) Find the area of the snowflake, and compare it with the area of the initial triangle.
  • e) What fraction of the final area is already present after step 22? Explain in one sentence why the perimeter diverges while the area converges.
Show the solution

Answers

  • a) Nk=3⋅4kN_k = 3 \cdot 4^k, ℓk=3−k\ell_k = 3^{-k}, Pk=3(43)kP_k = 3\left(\frac{4}{3}\right)^k
  • b) Pk→∞P_k \to \infty; Pk=3+∑j=1k(43)j−1P_k = 3 + \sum_{j=1}^{k} \left(\frac{4}{3}\right)^{j-1}, geometric with r=43>1r = \frac{4}{3} > 1.
  • c) 3⋅4k−13 \cdot 4^{k-1} new triangles of area 34⋅9−k\frac{\sqrt{3}}{4} \cdot 9^{-k}.
  • d) A=34+3/121−4/9=235A = \frac{\sqrt{3}}{4} + \frac{\sqrt{3}/12}{1 - 4/9} = \frac{2\sqrt{3}}{5}, that is 85\frac{8}{5} of the triangle.
  • e) A2=10327A_2 = \frac{10\sqrt{3}}{27}, that is 2527\frac{25}{27} of the final area; the number of pieces grows by 44, their area shrinks by 99.

a) Each step replaces every side by 44 sides a third as long. So Nk=3⋅4kN_k = 3 \cdot 4^k and ℓk=13k\ell_k = \frac{1}{3^k}, and Pk=Nkℓk=3⋅4k3k=3(43)kP_k = N_k \ell_k = 3 \cdot \frac{4^k}{3^k} = 3\left(\frac{4}{3}\right)^k. Check on the figure: step 11 has 1212 sides of length 13\frac{1}{3}, perimeter 44, and indeed 3⋅43=43 \cdot \frac{4}{3} = 4. Step 22 has 4848 sides, perimeter 163\frac{16}{3}.

b) 43>1\frac{4}{3} > 1, so (43)k→∞\left(\frac{4}{3}\right)^k \to \infty and Pk→∞P_k \to \infty: the snowflake has an infinite perimeter. As a series: Pk−Pk−1=3(43)k−1(43−1)=(43)k−1P_k - P_{k-1} = 3\left(\frac{4}{3}\right)^{k-1}\left(\frac{4}{3} - 1\right) = \left(\frac{4}{3}\right)^{k-1}, so Pk=3+∑j=1k(43)j−1P_k = 3 + \sum_{j=1}^{k} \left(\frac{4}{3}\right)^{j-1}, the partial sums of a geometric series of ratio 43\frac{4}{3}, which diverges since ∣r∣≥1|r| \ge 1; its terms do not even tend to 00. Check: 3+1+43=163=P23 + 1 + \frac{4}{3} = \frac{16}{3} = P_2.

c) At step kk, one new triangle is built on each side present after step k−1k - 1, that is on Nk−1=3⋅4k−1N_{k-1} = 3 \cdot 4^{k-1} sides, and its side is a third of theirs, ℓk=3−k\ell_k = 3^{-k}. Each new triangle has area 34⋅19k\frac{\sqrt{3}}{4} \cdot \frac{1}{9^k}, so the area added is 3⋅4k−1⋅34⋅19k=334⋅9⋅4k−19k−1=312(49)k−13 \cdot 4^{k-1} \cdot \frac{\sqrt{3}}{4} \cdot \frac{1}{9^k} = \frac{3\sqrt{3}}{4 \cdot 9} \cdot \frac{4^{k-1}}{9^{k-1}} = \frac{\sqrt{3}}{12}\left(\frac{4}{9}\right)^{k-1}. Check at k=1k = 1: three triangles of side 13\frac{1}{3}, area 3⋅336=3123 \cdot \frac{\sqrt{3}}{36} = \frac{\sqrt{3}}{12}. The count uses Nk−1N_{k-1}, not NkN_k: the new triangles sit on the OLD sides, and using NkN_k multiplies the answer by 44.

d) The area is the initial triangle plus all the additions: A=34+∑k=1∞312(49)k−1A = \frac{\sqrt{3}}{4} + \sum_{k=1}^{\infty} \frac{\sqrt{3}}{12}\left(\frac{4}{9}\right)^{k-1}. The series is geometric with first term 312\frac{\sqrt{3}}{12} and ratio 49<1\frac{4}{9} < 1, so it converges to 3/125/9=9360=3320\frac{\sqrt{3}/12}{5/9} = \frac{9\sqrt{3}}{60} = \frac{3\sqrt{3}}{20}. Hence A=5320+3320=8320=235A = \frac{5\sqrt{3}}{20} + \frac{3\sqrt{3}}{20} = \frac{8\sqrt{3}}{20} = \frac{2\sqrt{3}}{5}, which is 85\frac{8}{5} of the initial area 34\frac{\sqrt{3}}{4}. With 3≈1.73\sqrt{3} \approx 1.73, about 0.690.69 square units against 0.430.43.

e) After step 22: A2=34+312+312⋅49=34(1+13+427)=34⋅4027=10327A_2 = \frac{\sqrt{3}}{4} + \frac{\sqrt{3}}{12} + \frac{\sqrt{3}}{12} \cdot \frac{4}{9} = \frac{\sqrt{3}}{4}\left(1 + \frac{1}{3} + \frac{4}{27}\right) = \frac{\sqrt{3}}{4} \cdot \frac{40}{27} = \frac{10\sqrt{3}}{27}. As a fraction of AA: 10/272/5=5054=2527\frac{10/27}{2/5} = \frac{50}{54} = \frac{25}{27}, about 93%93\%. Why the two verdicts differ: at each step the number of pieces is multiplied by 44, while a length is divided by 33 and an area by 99; the perimeter increments are therefore multiplied by 43>1\frac{4}{3} > 1 and the area increments by 49<1\frac{4}{9} < 1. Two geometric series, one ratio on each side of 11: a finite region can have an infinitely long boundary.

See also

Struggling with MATH 141?

I tutor first-year calculus at McGill and Concordia, in English or in French, in Montreal or online. Get in touch for a first session.

Site by Studio Squalli